About 2-cycloheptyl-4,6-dihydro-1H-thieno[3,4-c]pyrazol-3-one
2-cycloheptyl-4,6-dihydro-1H-thieno[3,4-c]pyrazol-3-one (PubChem CID 83196568) has the molecular formula C12H18N2OS
and a molecular weight of 238.36 g/mol. Its IUPAC name is 2-cycloheptyl-4,6-dihydro-1H-thieno[3,4-c]pyrazol-3-one.
Molecular Properties
| Compound Name | 2-cycloheptyl-4,6-dihydro-1H-thieno[3,4-c]pyrazol-3-one |
| PubChem CID | 83196568 |
| Molecular Formula | C12H18N2OS |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 2-cycloheptyl-4,6-dihydro-1H-thieno[3,4-c]pyrazol-3-one |
| SMILES | O=c1c2c([nH]n1C1CCCCCC1)CSC2 |
| InChI | InChI=1S/C12H18N2OS/c15-12-10-7-16-8-11(10)13-14(12)9-5-3-1-2-4-6-9/h9,13H,1-8H2 |
| InChIKey | LDCOANIEZDMGGA-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-cycloheptyl-4,6-dihydro-1H-thieno[3,4-c]pyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cycloheptyl-4,6-dihydro-1H-thieno[3,4-c]pyrazol-3-one?
The IUPAC name of 2-cycloheptyl-4,6-dihydro-1H-thieno[3,4-c]pyrazol-3-one (CID 83196568) is 2-cycloheptyl-4,6-dihydro-1H-thieno[3,4-c]pyrazol-3-one.
What is the SMILES notation for 2-cycloheptyl-4,6-dihydro-1H-thieno[3,4-c]pyrazol-3-one?
The canonical SMILES for 2-cycloheptyl-4,6-dihydro-1H-thieno[3,4-c]pyrazol-3-one is O=c1c2c([nH]n1C1CCCCCC1)CSC2.
What is the InChIKey of 2-cycloheptyl-4,6-dihydro-1H-thieno[3,4-c]pyrazol-3-one?
The InChIKey is LDCOANIEZDMGGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2OS/c15-12-10-7-16-8-11(10)13-14(12)9-5-3-1-2-4-6-9/h9,13H,1-8H2.
What are the key properties of 2-cycloheptyl-4,6-dihydro-1H-thieno[3,4-c]pyrazol-3-one?
2-cycloheptyl-4,6-dihydro-1H-thieno[3,4-c]pyrazol-3-one has a molecular weight of 238.36 g/mol, XLogP of 2.82, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cycloheptyl-4,6-dihydro-1H-thieno[3,4-c]pyrazol-3-one is sourced from PubChem (CID 83196568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).