C14H25N3O2 — CID 83197137
3-(3-methoxypropyl)-5-(2-piperidin-3-ylpropan-2-yl)-1,2,4-oxadiazole (PubChem CID 83197137) has the molecular formula C14H25N3O2 and a molecular weight of 267.37 g/mol. Its IUPAC name is 3-(3-methoxypropyl)-5-(2-piperidin-3-ylpropan-2-yl)-1,2,4-oxadiazole.
| Compound Name | 3-(3-methoxypropyl)-5-(2-piperidin-3-ylpropan-2-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 83197137 |
| Molecular Formula | C14H25N3O2 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.19 |
| IUPAC Name | 3-(3-methoxypropyl)-5-(2-piperidin-3-ylpropan-2-yl)-1,2,4-oxadiazole |
| SMILES | COCCCc1noc(C(C)(C)C2CCCNC2)n1 |
| InChI | InChI=1S/C14H25N3O2/c1-14(2,11-6-4-8-15-10-11)13-16-12(17-19-13)7-5-9-18-3/h11,15H,4-10H2,1-3H3 |
| InChIKey | QWZIBJZXSPJKPZ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|