C13H15BrO4 — CID 83197947
methyl 2-bromo-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)propanoate (PubChem CID 83197947) has the molecular formula C13H15BrO4 and a molecular weight of 315.16 g/mol. Its IUPAC name is methyl 2-bromo-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)propanoate.
| Compound Name | methyl 2-bromo-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)propanoate |
|---|---|
| PubChem CID | 83197947 |
| Molecular Formula | C13H15BrO4 |
| Molecular Weight | 315.16 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | methyl 2-bromo-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)propanoate |
| SMILES | COC(=O)C(Br)Cc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C13H15BrO4/c1-16-13(15)10(14)7-9-3-4-11-12(8-9)18-6-2-5-17-11/h3-4,8,10H,2,5-7H2,1H3 |
| InChIKey | WKNNJSRRHMLWSF-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.16 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|