C15H20F2N2O — CID 83198550
N-(2,5-difluorophenyl)-2-methyl-2-piperidin-3-ylpropanamide (PubChem CID 83198550) has the molecular formula C15H20F2N2O and a molecular weight of 282.33 g/mol. Its IUPAC name is N-(2,5-difluorophenyl)-2-methyl-2-piperidin-3-ylpropanamide.
| Compound Name | N-(2,5-difluorophenyl)-2-methyl-2-piperidin-3-ylpropanamide |
|---|---|
| PubChem CID | 83198550 |
| Molecular Formula | C15H20F2N2O |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | N-(2,5-difluorophenyl)-2-methyl-2-piperidin-3-ylpropanamide |
| SMILES | CC(C)(C(=O)Nc1cc(F)ccc1F)C1CCCNC1 |
| InChI | InChI=1S/C15H20F2N2O/c1-15(2,10-4-3-7-18-9-10)14(20)19-13-8-11(16)5-6-12(13)17/h5-6,8,10,18H,3-4,7,9H2,1-2H3,(H,19,20) |
| InChIKey | FXYWORWFVKVNPJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |