About (2-propan-2-yl-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl)hydrazine
(2-propan-2-yl-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl)hydrazine (PubChem CID 83200451) has the molecular formula C9H14N4S
and a molecular weight of 210.31 g/mol. Its IUPAC name is (2-propan-2-yl-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl)hydrazine.
Molecular Properties
| Compound Name | (2-propan-2-yl-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl)hydrazine |
| PubChem CID | 83200451 |
| Molecular Formula | C9H14N4S |
| Molecular Weight | 210.31 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | (2-propan-2-yl-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl)hydrazine |
| SMILES | CC(C)c1nc2c(c(NN)n1)CSC2 |
| InChI | InChI=1S/C9H14N4S/c1-5(2)8-11-7-4-14-3-6(7)9(12-8)13-10/h5H,3-4,10H2,1-2H3,(H,11,12,13) |
| InChIKey | DFJDCQOKGAPNEC-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.31 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-propan-2-yl-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-propan-2-yl-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl)hydrazine?
The IUPAC name of (2-propan-2-yl-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl)hydrazine (CID 83200451) is (2-propan-2-yl-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl)hydrazine.
What is the SMILES notation for (2-propan-2-yl-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl)hydrazine?
The canonical SMILES for (2-propan-2-yl-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl)hydrazine is CC(C)c1nc2c(c(NN)n1)CSC2.
What is the InChIKey of (2-propan-2-yl-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl)hydrazine?
The InChIKey is DFJDCQOKGAPNEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N4S/c1-5(2)8-11-7-4-14-3-6(7)9(12-8)13-10/h5H,3-4,10H2,1-2H3,(H,11,12,13).
What are the key properties of (2-propan-2-yl-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl)hydrazine?
(2-propan-2-yl-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl)hydrazine has a molecular weight of 210.31 g/mol, XLogP of 1.63, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-propan-2-yl-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl)hydrazine is sourced from PubChem (CID 83200451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).