C12H13N3O2S — CID 83200548
4-[3-(pyridin-4-ylmethyl)-1,2,4-oxadiazol-5-yl]thiolan-3-ol (PubChem CID 83200548) has the molecular formula C12H13N3O2S and a molecular weight of 263.32 g/mol. Its IUPAC name is 4-[3-(pyridin-4-ylmethyl)-1,2,4-oxadiazol-5-yl]thiolan-3-ol.
| Compound Name | 4-[3-(pyridin-4-ylmethyl)-1,2,4-oxadiazol-5-yl]thiolan-3-ol |
|---|---|
| PubChem CID | 83200548 |
| Molecular Formula | C12H13N3O2S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 4-[3-(pyridin-4-ylmethyl)-1,2,4-oxadiazol-5-yl]thiolan-3-ol |
| SMILES | OC1CSCC1c1nc(Cc2ccncc2)no1 |
| InChI | InChI=1S/C12H13N3O2S/c16-10-7-18-6-9(10)12-14-11(15-17-12)5-8-1-3-13-4-2-8/h1-4,9-10,16H,5-7H2 |
| InChIKey | HESAWDBLODHCBE-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 72.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |