C13H21N3OS — CID 83200734
4-(3-cycloheptyl-1,2,4-oxadiazol-5-yl)thiolan-3-amine (PubChem CID 83200734) has the molecular formula C13H21N3OS and a molecular weight of 267.40 g/mol. Its IUPAC name is 4-(3-cycloheptyl-1,2,4-oxadiazol-5-yl)thiolan-3-amine.
| Compound Name | 4-(3-cycloheptyl-1,2,4-oxadiazol-5-yl)thiolan-3-amine |
|---|---|
| PubChem CID | 83200734 |
| Molecular Formula | C13H21N3OS |
| Molecular Weight | 267.40 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 4-(3-cycloheptyl-1,2,4-oxadiazol-5-yl)thiolan-3-amine |
| SMILES | NC1CSCC1c1nc(C2CCCCCC2)no1 |
| InChI | InChI=1S/C13H21N3OS/c14-11-8-18-7-10(11)13-15-12(16-17-13)9-5-3-1-2-4-6-9/h9-11H,1-8,14H2 |
| InChIKey | QKHSCJLQTPYSBX-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |