C14H15N3O2S — CID 83201180
2-(2,3-dimethoxyphenyl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine (PubChem CID 83201180) has the molecular formula C14H15N3O2S and a molecular weight of 289.36 g/mol. Its IUPAC name is 2-(2,3-dimethoxyphenyl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine.
| Compound Name | 2-(2,3-dimethoxyphenyl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 83201180 |
| Molecular Formula | C14H15N3O2S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 2-(2,3-dimethoxyphenyl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine |
| SMILES | COc1cccc(-c2nc(N)c3c(n2)CSC3)c1OC |
| InChI | InChI=1S/C14H15N3O2S/c1-18-11-5-3-4-8(12(11)19-2)14-16-10-7-20-6-9(10)13(15)17-14/h3-5H,6-7H2,1-2H3,(H2,15,16,17) |
| InChIKey | CYXFGZCAKDPVEA-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |