About 4-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)thiolan-3-one
4-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)thiolan-3-one (PubChem CID 83201200) has the molecular formula C9H12N2O2S
and a molecular weight of 212.27 g/mol. Its IUPAC name is 4-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)thiolan-3-one.
Molecular Properties
| Compound Name | 4-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)thiolan-3-one |
| PubChem CID | 83201200 |
| Molecular Formula | C9H12N2O2S |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | 4-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)thiolan-3-one |
| SMILES | CC(C)c1noc(C2CSCC2=O)n1 |
| InChI | InChI=1S/C9H12N2O2S/c1-5(2)8-10-9(13-11-8)6-3-14-4-7(6)12/h5-6H,3-4H2,1-2H3 |
| InChIKey | UYELUSOXGZBWSY-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)thiolan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)thiolan-3-one?
The IUPAC name of 4-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)thiolan-3-one (CID 83201200) is 4-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)thiolan-3-one.
What is the SMILES notation for 4-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)thiolan-3-one?
The canonical SMILES for 4-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)thiolan-3-one is CC(C)c1noc(C2CSCC2=O)n1.
What is the InChIKey of 4-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)thiolan-3-one?
The InChIKey is UYELUSOXGZBWSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O2S/c1-5(2)8-10-9(13-11-8)6-3-14-4-7(6)12/h5-6H,3-4H2,1-2H3.
What are the key properties of 4-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)thiolan-3-one?
4-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)thiolan-3-one has a molecular weight of 212.27 g/mol, XLogP of 1.59, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)thiolan-3-one is sourced from PubChem (CID 83201200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).