C10H14N2O2S3 — CID 83201621
4-[3-(1,4-dithian-2-yl)-1,2,4-oxadiazol-5-yl]thiolan-3-ol (PubChem CID 83201621) has the molecular formula C10H14N2O2S3 and a molecular weight of 290.44 g/mol. Its IUPAC name is 4-[3-(1,4-dithian-2-yl)-1,2,4-oxadiazol-5-yl]thiolan-3-ol.
| Compound Name | 4-[3-(1,4-dithian-2-yl)-1,2,4-oxadiazol-5-yl]thiolan-3-ol |
|---|---|
| PubChem CID | 83201621 |
| Molecular Formula | C10H14N2O2S3 |
| Molecular Weight | 290.44 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | 4-[3-(1,4-dithian-2-yl)-1,2,4-oxadiazol-5-yl]thiolan-3-ol |
| SMILES | OC1CSCC1c1nc(C2CSCCS2)no1 |
| InChI | InChI=1S/C10H14N2O2S3/c13-7-4-16-3-6(7)10-11-9(12-14-10)8-5-15-1-2-17-8/h6-8,13H,1-5H2 |
| InChIKey | JFLBPMJNLLGXCX-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.44 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |