About 4-[3-(2H-triazol-4-yl)-1,2,4-oxadiazol-5-yl]thiolan-3-amine
4-[3-(2H-triazol-4-yl)-1,2,4-oxadiazol-5-yl]thiolan-3-amine (PubChem CID 83201649) has the molecular formula C8H10N6OS
and a molecular weight of 238.28 g/mol. Its IUPAC name is 4-[3-(2H-triazol-4-yl)-1,2,4-oxadiazol-5-yl]thiolan-3-amine.
Molecular Properties
| Compound Name | 4-[3-(2H-triazol-4-yl)-1,2,4-oxadiazol-5-yl]thiolan-3-amine |
| PubChem CID | 83201649 |
| Molecular Formula | C8H10N6OS |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 4-[3-(2H-triazol-4-yl)-1,2,4-oxadiazol-5-yl]thiolan-3-amine |
| SMILES | NC1CSCC1c1nc(-c2cn[nH]n2)no1 |
| InChI | InChI=1S/C8H10N6OS/c9-5-3-16-2-4(5)8-11-7(13-15-8)6-1-10-14-12-6/h1,4-5H,2-3,9H2,(H,10,12,14) |
| InChIKey | BKYWTQRIZWKSHX-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 106.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[3-(2H-triazol-4-yl)-1,2,4-oxadiazol-5-yl]thiolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(2H-triazol-4-yl)-1,2,4-oxadiazol-5-yl]thiolan-3-amine?
The IUPAC name of 4-[3-(2H-triazol-4-yl)-1,2,4-oxadiazol-5-yl]thiolan-3-amine (CID 83201649) is 4-[3-(2H-triazol-4-yl)-1,2,4-oxadiazol-5-yl]thiolan-3-amine.
What is the SMILES notation for 4-[3-(2H-triazol-4-yl)-1,2,4-oxadiazol-5-yl]thiolan-3-amine?
The canonical SMILES for 4-[3-(2H-triazol-4-yl)-1,2,4-oxadiazol-5-yl]thiolan-3-amine is NC1CSCC1c1nc(-c2cn[nH]n2)no1.
What is the InChIKey of 4-[3-(2H-triazol-4-yl)-1,2,4-oxadiazol-5-yl]thiolan-3-amine?
The InChIKey is BKYWTQRIZWKSHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N6OS/c9-5-3-16-2-4(5)8-11-7(13-15-8)6-1-10-14-12-6/h1,4-5H,2-3,9H2,(H,10,12,14).
What are the key properties of 4-[3-(2H-triazol-4-yl)-1,2,4-oxadiazol-5-yl]thiolan-3-amine?
4-[3-(2H-triazol-4-yl)-1,2,4-oxadiazol-5-yl]thiolan-3-amine has a molecular weight of 238.28 g/mol, XLogP of 0.01, 2 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(2H-triazol-4-yl)-1,2,4-oxadiazol-5-yl]thiolan-3-amine is sourced from PubChem (CID 83201649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).