About 4-(2-ethoxyethylamino)-N,N-dimethylpiperidine-1-carboxamide
4-(2-ethoxyethylamino)-N,N-dimethylpiperidine-1-carboxamide (PubChem CID 83201988) has the molecular formula C12H25N3O2
and a molecular weight of 243.35 g/mol. Its IUPAC name is 4-(2-ethoxyethylamino)-N,N-dimethylpiperidine-1-carboxamide.
Molecular Properties
| Compound Name | 4-(2-ethoxyethylamino)-N,N-dimethylpiperidine-1-carboxamide |
| PubChem CID | 83201988 |
| Molecular Formula | C12H25N3O2 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.19 |
| IUPAC Name | 4-(2-ethoxyethylamino)-N,N-dimethylpiperidine-1-carboxamide |
| SMILES | CCOCCNC1CCN(C(=O)N(C)C)CC1 |
| InChI | InChI=1S/C12H25N3O2/c1-4-17-10-7-13-11-5-8-15(9-6-11)12(16)14(2)3/h11,13H,4-10H2,1-3H3 |
| InChIKey | HBJJUTTUEUGZQM-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-ethoxyethylamino)-N,N-dimethylpiperidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-ethoxyethylamino)-N,N-dimethylpiperidine-1-carboxamide?
The IUPAC name of 4-(2-ethoxyethylamino)-N,N-dimethylpiperidine-1-carboxamide (CID 83201988) is 4-(2-ethoxyethylamino)-N,N-dimethylpiperidine-1-carboxamide.
What is the SMILES notation for 4-(2-ethoxyethylamino)-N,N-dimethylpiperidine-1-carboxamide?
The canonical SMILES for 4-(2-ethoxyethylamino)-N,N-dimethylpiperidine-1-carboxamide is CCOCCNC1CCN(C(=O)N(C)C)CC1.
What is the InChIKey of 4-(2-ethoxyethylamino)-N,N-dimethylpiperidine-1-carboxamide?
The InChIKey is HBJJUTTUEUGZQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25N3O2/c1-4-17-10-7-13-11-5-8-15(9-6-11)12(16)14(2)3/h11,13H,4-10H2,1-3H3.
What are the key properties of 4-(2-ethoxyethylamino)-N,N-dimethylpiperidine-1-carboxamide?
4-(2-ethoxyethylamino)-N,N-dimethylpiperidine-1-carboxamide has a molecular weight of 243.35 g/mol, XLogP of 0.76, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-ethoxyethylamino)-N,N-dimethylpiperidine-1-carboxamide is sourced from PubChem (CID 83201988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).