C9H15N3O2S — CID 83202234
2-[1-(4-methyl-1,3-thiazol-5-yl)ethylamino]ethyl carbamate (PubChem CID 83202234) has the molecular formula C9H15N3O2S and a molecular weight of 229.30 g/mol. Its IUPAC name is 2-[1-(4-methyl-1,3-thiazol-5-yl)ethylamino]ethyl carbamate.
| Compound Name | 2-[1-(4-methyl-1,3-thiazol-5-yl)ethylamino]ethyl carbamate |
|---|---|
| PubChem CID | 83202234 |
| Molecular Formula | C9H15N3O2S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 2-[1-(4-methyl-1,3-thiazol-5-yl)ethylamino]ethyl carbamate |
| SMILES | Cc1ncsc1C(C)NCCOC(N)=O |
| InChI | InChI=1S/C9H15N3O2S/c1-6(8-7(2)12-5-15-8)11-3-4-14-9(10)13/h5-6,11H,3-4H2,1-2H3,(H2,10,13) |
| InChIKey | DEHBKITUAJFAQQ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|