About N-cyclopentyloxy-3,5-difluorobenzamide
N-cyclopentyloxy-3,5-difluorobenzamide (PubChem CID 83202361) has the molecular formula C12H13F2NO2
and a molecular weight of 241.24 g/mol. Its IUPAC name is N-cyclopentyloxy-3,5-difluorobenzamide.
Molecular Properties
| Compound Name | N-cyclopentyloxy-3,5-difluorobenzamide |
| PubChem CID | 83202361 |
| Molecular Formula | C12H13F2NO2 |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | N-cyclopentyloxy-3,5-difluorobenzamide |
| SMILES | O=C(NOC1CCCC1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C12H13F2NO2/c13-9-5-8(6-10(14)7-9)12(16)15-17-11-3-1-2-4-11/h5-7,11H,1-4H2,(H,15,16) |
| InChIKey | WAVOJVSNLDDSNB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-cyclopentyloxy-3,5-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyloxy-3,5-difluorobenzamide?
The IUPAC name of N-cyclopentyloxy-3,5-difluorobenzamide (CID 83202361) is N-cyclopentyloxy-3,5-difluorobenzamide.
What is the SMILES notation for N-cyclopentyloxy-3,5-difluorobenzamide?
The canonical SMILES for N-cyclopentyloxy-3,5-difluorobenzamide is O=C(NOC1CCCC1)c1cc(F)cc(F)c1.
What is the InChIKey of N-cyclopentyloxy-3,5-difluorobenzamide?
The InChIKey is WAVOJVSNLDDSNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13F2NO2/c13-9-5-8(6-10(14)7-9)12(16)15-17-11-3-1-2-4-11/h5-7,11H,1-4H2,(H,15,16).
What are the key properties of N-cyclopentyloxy-3,5-difluorobenzamide?
N-cyclopentyloxy-3,5-difluorobenzamide has a molecular weight of 241.24 g/mol, XLogP of 2.57, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyloxy-3,5-difluorobenzamide is sourced from PubChem (CID 83202361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).