About 2-[(4-amino-1,3-benzoxazol-2-yl)amino]ethyl carbamate
2-[(4-amino-1,3-benzoxazol-2-yl)amino]ethyl carbamate (PubChem CID 83202383) has the molecular formula C10H12N4O3
and a molecular weight of 236.23 g/mol. Its IUPAC name is 2-[(4-amino-1,3-benzoxazol-2-yl)amino]ethyl carbamate.
Molecular Properties
| Compound Name | 2-[(4-amino-1,3-benzoxazol-2-yl)amino]ethyl carbamate |
| PubChem CID | 83202383 |
| Molecular Formula | C10H12N4O3 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | 2-[(4-amino-1,3-benzoxazol-2-yl)amino]ethyl carbamate |
| SMILES | NC(=O)OCCNc1nc2c(N)cccc2o1 |
| InChI | InChI=1S/C10H12N4O3/c11-6-2-1-3-7-8(6)14-10(17-7)13-4-5-16-9(12)15/h1-3H,4-5,11H2,(H2,12,15)(H,13,14) |
| InChIKey | XMTPWIGANQWZBM-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4-amino-1,3-benzoxazol-2-yl)amino]ethyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-amino-1,3-benzoxazol-2-yl)amino]ethyl carbamate?
The IUPAC name of 2-[(4-amino-1,3-benzoxazol-2-yl)amino]ethyl carbamate (CID 83202383) is 2-[(4-amino-1,3-benzoxazol-2-yl)amino]ethyl carbamate.
What is the SMILES notation for 2-[(4-amino-1,3-benzoxazol-2-yl)amino]ethyl carbamate?
The canonical SMILES for 2-[(4-amino-1,3-benzoxazol-2-yl)amino]ethyl carbamate is NC(=O)OCCNc1nc2c(N)cccc2o1.
What is the InChIKey of 2-[(4-amino-1,3-benzoxazol-2-yl)amino]ethyl carbamate?
The InChIKey is XMTPWIGANQWZBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4O3/c11-6-2-1-3-7-8(6)14-10(17-7)13-4-5-16-9(12)15/h1-3H,4-5,11H2,(H2,12,15)(H,13,14).
What are the key properties of 2-[(4-amino-1,3-benzoxazol-2-yl)amino]ethyl carbamate?
2-[(4-amino-1,3-benzoxazol-2-yl)amino]ethyl carbamate has a molecular weight of 236.23 g/mol, XLogP of 0.92, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-amino-1,3-benzoxazol-2-yl)amino]ethyl carbamate is sourced from PubChem (CID 83202383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).