About N-cyclopentyloxy-1,3-thiazole-4-carboxamide
N-cyclopentyloxy-1,3-thiazole-4-carboxamide (PubChem CID 83202530) has the molecular formula C9H12N2O2S
and a molecular weight of 212.27 g/mol. Its IUPAC name is N-cyclopentyloxy-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | N-cyclopentyloxy-1,3-thiazole-4-carboxamide |
| PubChem CID | 83202530 |
| Molecular Formula | C9H12N2O2S |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | N-cyclopentyloxy-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NOC1CCCC1)c1cscn1 |
| InChI | InChI=1S/C9H12N2O2S/c12-9(8-5-14-6-10-8)11-13-7-3-1-2-4-7/h5-7H,1-4H2,(H,11,12) |
| InChIKey | WDMCJWWJPPCBLR-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-cyclopentyloxy-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyloxy-1,3-thiazole-4-carboxamide?
The IUPAC name of N-cyclopentyloxy-1,3-thiazole-4-carboxamide (CID 83202530) is N-cyclopentyloxy-1,3-thiazole-4-carboxamide.
What is the SMILES notation for N-cyclopentyloxy-1,3-thiazole-4-carboxamide?
The canonical SMILES for N-cyclopentyloxy-1,3-thiazole-4-carboxamide is O=C(NOC1CCCC1)c1cscn1.
What is the InChIKey of N-cyclopentyloxy-1,3-thiazole-4-carboxamide?
The InChIKey is WDMCJWWJPPCBLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O2S/c12-9(8-5-14-6-10-8)11-13-7-3-1-2-4-7/h5-7H,1-4H2,(H,11,12).
What are the key properties of N-cyclopentyloxy-1,3-thiazole-4-carboxamide?
N-cyclopentyloxy-1,3-thiazole-4-carboxamide has a molecular weight of 212.27 g/mol, XLogP of 1.75, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyloxy-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 83202530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).