C9H9N5O4 — CID 83203409
2-[(3-cyano-5-nitro-2-pyridinyl)amino]ethyl carbamate (PubChem CID 83203409) has the molecular formula C9H9N5O4 and a molecular weight of 251.20 g/mol. Its IUPAC name is 2-[(3-cyano-5-nitro-2-pyridinyl)amino]ethyl carbamate.
| Compound Name | 2-[(3-cyano-5-nitro-2-pyridinyl)amino]ethyl carbamate |
|---|---|
| PubChem CID | 83203409 |
| Molecular Formula | C9H9N5O4 |
| Molecular Weight | 251.20 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 2-[(3-cyano-5-nitro-2-pyridinyl)amino]ethyl carbamate |
| SMILES | N#Cc1cc([N+](=O)[O-])cnc1NCCOC(N)=O |
| InChI | InChI=1S/C9H9N5O4/c10-4-6-3-7(14(16)17)5-13-8(6)12-1-2-18-9(11)15/h3,5H,1-2H2,(H2,11,15)(H,12,13) |
| InChIKey | OTDKGGCEDFIEAU-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 144.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.20 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|