C17H16BrN3 — CID 83203583
1-(4-bromophenyl)-3-(2,4-dimethylphenyl)pyrazol-4-amine (PubChem CID 83203583) has the molecular formula C17H16BrN3 and a molecular weight of 342.24 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-(2,4-dimethylphenyl)pyrazol-4-amine.
| Compound Name | 1-(4-bromophenyl)-3-(2,4-dimethylphenyl)pyrazol-4-amine |
|---|---|
| PubChem CID | 83203583 |
| Molecular Formula | C17H16BrN3 |
| Molecular Weight | 342.24 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 1-(4-bromophenyl)-3-(2,4-dimethylphenyl)pyrazol-4-amine |
| SMILES | Cc1ccc(-c2nn(-c3ccc(Br)cc3)cc2N)c(C)c1 |
| InChI | InChI=1S/C17H16BrN3/c1-11-3-8-15(12(2)9-11)17-16(19)10-21(20-17)14-6-4-13(18)5-7-14/h3-10H,19H2,1-2H3 |
| InChIKey | KHBSHMJEJORMSP-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.24 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |