About 2-[5-(chloromethyl)-1-methyl-3-propylimidazo[4,5-d]pyrazol-6-yl]ethyl carbamate
2-[5-(chloromethyl)-1-methyl-3-propylimidazo[4,5-d]pyrazol-6-yl]ethyl carbamate (PubChem CID 83203895) has the molecular formula C12H18ClN5O2
and a molecular weight of 299.76 g/mol. Its IUPAC name is 2-[5-(chloromethyl)-1-methyl-3-propylimidazo[4,5-d]pyrazol-6-yl]ethyl carbamate.
Molecular Properties
| Compound Name | 2-[5-(chloromethyl)-1-methyl-3-propylimidazo[4,5-d]pyrazol-6-yl]ethyl carbamate |
| PubChem CID | 83203895 |
| Molecular Formula | C12H18ClN5O2 |
| Molecular Weight | 299.76 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 2-[5-(chloromethyl)-1-methyl-3-propylimidazo[4,5-d]pyrazol-6-yl]ethyl carbamate |
| SMILES | CCCc1nn(C)c2c1nc(CCl)n2CCOC(N)=O |
| InChI | InChI=1S/C12H18ClN5O2/c1-3-4-8-10-11(17(2)16-8)18(9(7-13)15-10)5-6-20-12(14)19/h3-7H2,1-2H3,(H2,14,19) |
| InChIKey | DZZLHRUPVJXOLK-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 87.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.76 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[5-(chloromethyl)-1-methyl-3-propylimidazo[4,5-d]pyrazol-6-yl]ethyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(chloromethyl)-1-methyl-3-propylimidazo[4,5-d]pyrazol-6-yl]ethyl carbamate?
The IUPAC name of 2-[5-(chloromethyl)-1-methyl-3-propylimidazo[4,5-d]pyrazol-6-yl]ethyl carbamate (CID 83203895) is 2-[5-(chloromethyl)-1-methyl-3-propylimidazo[4,5-d]pyrazol-6-yl]ethyl carbamate.
What is the SMILES notation for 2-[5-(chloromethyl)-1-methyl-3-propylimidazo[4,5-d]pyrazol-6-yl]ethyl carbamate?
The canonical SMILES for 2-[5-(chloromethyl)-1-methyl-3-propylimidazo[4,5-d]pyrazol-6-yl]ethyl carbamate is CCCc1nn(C)c2c1nc(CCl)n2CCOC(N)=O.
What is the InChIKey of 2-[5-(chloromethyl)-1-methyl-3-propylimidazo[4,5-d]pyrazol-6-yl]ethyl carbamate?
The InChIKey is DZZLHRUPVJXOLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18ClN5O2/c1-3-4-8-10-11(17(2)16-8)18(9(7-13)15-10)5-6-20-12(14)19/h3-7H2,1-2H3,(H2,14,19).
What are the key properties of 2-[5-(chloromethyl)-1-methyl-3-propylimidazo[4,5-d]pyrazol-6-yl]ethyl carbamate?
2-[5-(chloromethyl)-1-methyl-3-propylimidazo[4,5-d]pyrazol-6-yl]ethyl carbamate has a molecular weight of 299.76 g/mol, XLogP of 1.56, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(chloromethyl)-1-methyl-3-propylimidazo[4,5-d]pyrazol-6-yl]ethyl carbamate is sourced from PubChem (CID 83203895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).