About 2-(2-sulfanylidene-1H-imidazo[4,5-b]pyridin-3-yl)ethyl carbamate
2-(2-sulfanylidene-1H-imidazo[4,5-b]pyridin-3-yl)ethyl carbamate (PubChem CID 83204055) has the molecular formula C9H10N4O2S
and a molecular weight of 238.27 g/mol. Its IUPAC name is 2-(2-sulfanylidene-1H-imidazo[4,5-b]pyridin-3-yl)ethyl carbamate.
Molecular Properties
| Compound Name | 2-(2-sulfanylidene-1H-imidazo[4,5-b]pyridin-3-yl)ethyl carbamate |
| PubChem CID | 83204055 |
| Molecular Formula | C9H10N4O2S |
| Molecular Weight | 238.27 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 2-(2-sulfanylidene-1H-imidazo[4,5-b]pyridin-3-yl)ethyl carbamate |
| SMILES | NC(=O)OCCn1c(=S)[nH]c2cccnc21 |
| InChI | InChI=1S/C9H10N4O2S/c10-8(14)15-5-4-13-7-6(12-9(13)16)2-1-3-11-7/h1-3H,4-5H2,(H2,10,14)(H,12,16) |
| InChIKey | RAULBZPEUWONDY-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 85.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.27 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-sulfanylidene-1H-imidazo[4,5-b]pyridin-3-yl)ethyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-sulfanylidene-1H-imidazo[4,5-b]pyridin-3-yl)ethyl carbamate?
The IUPAC name of 2-(2-sulfanylidene-1H-imidazo[4,5-b]pyridin-3-yl)ethyl carbamate (CID 83204055) is 2-(2-sulfanylidene-1H-imidazo[4,5-b]pyridin-3-yl)ethyl carbamate.
What is the SMILES notation for 2-(2-sulfanylidene-1H-imidazo[4,5-b]pyridin-3-yl)ethyl carbamate?
The canonical SMILES for 2-(2-sulfanylidene-1H-imidazo[4,5-b]pyridin-3-yl)ethyl carbamate is NC(=O)OCCn1c(=S)[nH]c2cccnc21.
What is the InChIKey of 2-(2-sulfanylidene-1H-imidazo[4,5-b]pyridin-3-yl)ethyl carbamate?
The InChIKey is RAULBZPEUWONDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4O2S/c10-8(14)15-5-4-13-7-6(12-9(13)16)2-1-3-11-7/h1-3H,4-5H2,(H2,10,14)(H,12,16).
What are the key properties of 2-(2-sulfanylidene-1H-imidazo[4,5-b]pyridin-3-yl)ethyl carbamate?
2-(2-sulfanylidene-1H-imidazo[4,5-b]pyridin-3-yl)ethyl carbamate has a molecular weight of 238.27 g/mol, XLogP of 1.19, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-sulfanylidene-1H-imidazo[4,5-b]pyridin-3-yl)ethyl carbamate is sourced from PubChem (CID 83204055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).