About 3-(4-chlorophenyl)-1-(3,4-dichlorophenyl)pyrazol-4-amine
3-(4-chlorophenyl)-1-(3,4-dichlorophenyl)pyrazol-4-amine (PubChem CID 83204665) has the molecular formula C15H10Cl3N3
and a molecular weight of 338.63 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-(3,4-dichlorophenyl)pyrazol-4-amine.
Molecular Properties
| Compound Name | 3-(4-chlorophenyl)-1-(3,4-dichlorophenyl)pyrazol-4-amine |
| PubChem CID | 83204665 |
| Molecular Formula | C15H10Cl3N3 |
| Molecular Weight | 338.63 g/mol |
| Exact Mass | 336.99 |
| IUPAC Name | 3-(4-chlorophenyl)-1-(3,4-dichlorophenyl)pyrazol-4-amine |
| SMILES | Nc1cn(-c2ccc(Cl)c(Cl)c2)nc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H10Cl3N3/c16-10-3-1-9(2-4-10)15-14(19)8-21(20-15)11-5-6-12(17)13(18)7-11/h1-8H,19H2 |
| InChIKey | IMHAPUCDIZNRTD-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.63 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(4-chlorophenyl)-1-(3,4-dichlorophenyl)pyrazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chlorophenyl)-1-(3,4-dichlorophenyl)pyrazol-4-amine?
The IUPAC name of 3-(4-chlorophenyl)-1-(3,4-dichlorophenyl)pyrazol-4-amine (CID 83204665) is 3-(4-chlorophenyl)-1-(3,4-dichlorophenyl)pyrazol-4-amine.
What is the SMILES notation for 3-(4-chlorophenyl)-1-(3,4-dichlorophenyl)pyrazol-4-amine?
The canonical SMILES for 3-(4-chlorophenyl)-1-(3,4-dichlorophenyl)pyrazol-4-amine is Nc1cn(-c2ccc(Cl)c(Cl)c2)nc1-c1ccc(Cl)cc1.
What is the InChIKey of 3-(4-chlorophenyl)-1-(3,4-dichlorophenyl)pyrazol-4-amine?
The InChIKey is IMHAPUCDIZNRTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10Cl3N3/c16-10-3-1-9(2-4-10)15-14(19)8-21(20-15)11-5-6-12(17)13(18)7-11/h1-8H,19H2.
What are the key properties of 3-(4-chlorophenyl)-1-(3,4-dichlorophenyl)pyrazol-4-amine?
3-(4-chlorophenyl)-1-(3,4-dichlorophenyl)pyrazol-4-amine has a molecular weight of 338.63 g/mol, XLogP of 5.08, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chlorophenyl)-1-(3,4-dichlorophenyl)pyrazol-4-amine is sourced from PubChem (CID 83204665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).