About 2-[(3-carbamothioyl-6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)amino]ethyl carbamate
2-[(3-carbamothioyl-6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)amino]ethyl carbamate (PubChem CID 83204822) has the molecular formula C12H16N4O2S
and a molecular weight of 280.35 g/mol. Its IUPAC name is 2-[(3-carbamothioyl-6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)amino]ethyl carbamate.
Molecular Properties
| Compound Name | 2-[(3-carbamothioyl-6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)amino]ethyl carbamate |
| PubChem CID | 83204822 |
| Molecular Formula | C12H16N4O2S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 2-[(3-carbamothioyl-6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)amino]ethyl carbamate |
| SMILES | NC(=O)OCCNc1nc2c(cc1C(N)=S)CCC2 |
| InChI | InChI=1S/C12H16N4O2S/c13-10(19)8-6-7-2-1-3-9(7)16-11(8)15-4-5-18-12(14)17/h6H,1-5H2,(H2,13,19)(H2,14,17)(H,15,16) |
| InChIKey | WEIDMBUPGAMBJJ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3-carbamothioyl-6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)amino]ethyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3-carbamothioyl-6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)amino]ethyl carbamate?
The IUPAC name of 2-[(3-carbamothioyl-6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)amino]ethyl carbamate (CID 83204822) is 2-[(3-carbamothioyl-6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)amino]ethyl carbamate.
What is the SMILES notation for 2-[(3-carbamothioyl-6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)amino]ethyl carbamate?
The canonical SMILES for 2-[(3-carbamothioyl-6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)amino]ethyl carbamate is NC(=O)OCCNc1nc2c(cc1C(N)=S)CCC2.
What is the InChIKey of 2-[(3-carbamothioyl-6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)amino]ethyl carbamate?
The InChIKey is WEIDMBUPGAMBJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4O2S/c13-10(19)8-6-7-2-1-3-9(7)16-11(8)15-4-5-18-12(14)17/h6H,1-5H2,(H2,13,19)(H2,14,17)(H,15,16).
What are the key properties of 2-[(3-carbamothioyl-6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)amino]ethyl carbamate?
2-[(3-carbamothioyl-6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)amino]ethyl carbamate has a molecular weight of 280.35 g/mol, XLogP of 0.71, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-carbamothioyl-6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)amino]ethyl carbamate is sourced from PubChem (CID 83204822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).