About 2-[2-(1-chloroethyl)-4,6-difluorobenzimidazol-1-yl]ethyl carbamate
2-[2-(1-chloroethyl)-4,6-difluorobenzimidazol-1-yl]ethyl carbamate (PubChem CID 83205268) has the molecular formula C12H12ClF2N3O2
and a molecular weight of 303.70 g/mol. Its IUPAC name is 2-[2-(1-chloroethyl)-4,6-difluorobenzimidazol-1-yl]ethyl carbamate.
Molecular Properties
| Compound Name | 2-[2-(1-chloroethyl)-4,6-difluorobenzimidazol-1-yl]ethyl carbamate |
| PubChem CID | 83205268 |
| Molecular Formula | C12H12ClF2N3O2 |
| Molecular Weight | 303.70 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 2-[2-(1-chloroethyl)-4,6-difluorobenzimidazol-1-yl]ethyl carbamate |
| SMILES | CC(Cl)c1nc2c(F)cc(F)cc2n1CCOC(N)=O |
| InChI | InChI=1S/C12H12ClF2N3O2/c1-6(13)11-17-10-8(15)4-7(14)5-9(10)18(11)2-3-20-12(16)19/h4-6H,2-3H2,1H3,(H2,16,19) |
| InChIKey | DHLIXTXULTYQFM-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.70 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(1-chloroethyl)-4,6-difluorobenzimidazol-1-yl]ethyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(1-chloroethyl)-4,6-difluorobenzimidazol-1-yl]ethyl carbamate?
The IUPAC name of 2-[2-(1-chloroethyl)-4,6-difluorobenzimidazol-1-yl]ethyl carbamate (CID 83205268) is 2-[2-(1-chloroethyl)-4,6-difluorobenzimidazol-1-yl]ethyl carbamate.
What is the SMILES notation for 2-[2-(1-chloroethyl)-4,6-difluorobenzimidazol-1-yl]ethyl carbamate?
The canonical SMILES for 2-[2-(1-chloroethyl)-4,6-difluorobenzimidazol-1-yl]ethyl carbamate is CC(Cl)c1nc2c(F)cc(F)cc2n1CCOC(N)=O.
What is the InChIKey of 2-[2-(1-chloroethyl)-4,6-difluorobenzimidazol-1-yl]ethyl carbamate?
The InChIKey is DHLIXTXULTYQFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12ClF2N3O2/c1-6(13)11-17-10-8(15)4-7(14)5-9(10)18(11)2-3-20-12(16)19/h4-6H,2-3H2,1H3,(H2,16,19).
What are the key properties of 2-[2-(1-chloroethyl)-4,6-difluorobenzimidazol-1-yl]ethyl carbamate?
2-[2-(1-chloroethyl)-4,6-difluorobenzimidazol-1-yl]ethyl carbamate has a molecular weight of 303.70 g/mol, XLogP of 2.71, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(1-chloroethyl)-4,6-difluorobenzimidazol-1-yl]ethyl carbamate is sourced from PubChem (CID 83205268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).