C12H21N3O6 — CID 83205759
4-[2-carbamoyloxyethylcarbamoyl(propyl)amino]oxolane-3-carboxylic acid (PubChem CID 83205759) has the molecular formula C12H21N3O6 and a molecular weight of 303.32 g/mol. Its IUPAC name is 4-[2-carbamoyloxyethylcarbamoyl(propyl)amino]oxolane-3-carboxylic acid.
| Compound Name | 4-[2-carbamoyloxyethylcarbamoyl(propyl)amino]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 83205759 |
| Molecular Formula | C12H21N3O6 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 4-[2-carbamoyloxyethylcarbamoyl(propyl)amino]oxolane-3-carboxylic acid |
| SMILES | CCCN(C(=O)NCCOC(N)=O)C1COCC1C(=O)O |
| InChI | InChI=1S/C12H21N3O6/c1-2-4-15(9-7-20-6-8(9)10(16)17)12(19)14-3-5-21-11(13)18/h8-9H,2-7H2,1H3,(H2,13,18)(H,14,19)(H,16,17) |
| InChIKey | DPLNJPQRENEXRH-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 131.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|