C13H16N4O3S — CID 83206282
2-[(3-amino-4,6-dimethylthieno[3,2-c]pyridine-2-carbonyl)amino]ethyl carbamate (PubChem CID 83206282) has the molecular formula C13H16N4O3S and a molecular weight of 308.36 g/mol. Its IUPAC name is 2-[(3-amino-4,6-dimethylthieno[3,2-c]pyridine-2-carbonyl)amino]ethyl carbamate.
| Compound Name | 2-[(3-amino-4,6-dimethylthieno[3,2-c]pyridine-2-carbonyl)amino]ethyl carbamate |
|---|---|
| PubChem CID | 83206282 |
| Molecular Formula | C13H16N4O3S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 2-[(3-amino-4,6-dimethylthieno[3,2-c]pyridine-2-carbonyl)amino]ethyl carbamate |
| SMILES | Cc1cc2sc(C(=O)NCCOC(N)=O)c(N)c2c(C)n1 |
| InChI | InChI=1S/C13H16N4O3S/c1-6-5-8-9(7(2)17-6)10(14)11(21-8)12(18)16-3-4-20-13(15)19/h5H,3-4,14H2,1-2H3,(H2,15,19)(H,16,18) |
| InChIKey | ZHVYKRZPFFESPF-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 120.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|