C12H8F4N4O3 — CID 832063
1-ethyl-4-nitro-N-(2,3,5,6-tetrafluorophenyl)pyrazole-3-carboxamide (PubChem CID 832063) has the molecular formula C12H8F4N4O3 and a molecular weight of 332.21 g/mol. Its IUPAC name is 1-ethyl-4-nitro-N-(2,3,5,6-tetrafluorophenyl)pyrazole-3-carboxamide.
| Compound Name | 1-ethyl-4-nitro-N-(2,3,5,6-tetrafluorophenyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 832063 |
| Molecular Formula | C12H8F4N4O3 |
| Molecular Weight | 332.21 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 1-ethyl-4-nitro-N-(2,3,5,6-tetrafluorophenyl)pyrazole-3-carboxamide |
| SMILES | CCn1cc([N+](=O)[O-])c(C(=O)Nc2c(F)c(F)cc(F)c2F)n1 |
| InChI | InChI=1S/C12H8F4N4O3/c1-2-19-4-7(20(22)23)10(18-19)12(21)17-11-8(15)5(13)3-6(14)9(11)16/h3-4H,2H2,1H3,(H,17,21) |
| InChIKey | GEROZZPSCIZJOF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.21 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|