About N-cyclopentyloxy-3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanamide
N-cyclopentyloxy-3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanamide (PubChem CID 83206350) has the molecular formula C13H21N3O4
and a molecular weight of 283.33 g/mol. Its IUPAC name is N-cyclopentyloxy-3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanamide.
Molecular Properties
| Compound Name | N-cyclopentyloxy-3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanamide |
| PubChem CID | 83206350 |
| Molecular Formula | C13H21N3O4 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | N-cyclopentyloxy-3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanamide |
| SMILES | CC1(C)NC(=O)N(CCC(=O)NOC2CCCC2)C1=O |
| InChI | InChI=1S/C13H21N3O4/c1-13(2)11(18)16(12(19)14-13)8-7-10(17)15-20-9-5-3-4-6-9/h9H,3-8H2,1-2H3,(H,14,19)(H,15,17) |
| InChIKey | KKLVINAVXCQYQR-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-cyclopentyloxy-3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyloxy-3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanamide?
The IUPAC name of N-cyclopentyloxy-3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanamide (CID 83206350) is N-cyclopentyloxy-3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanamide.
What is the SMILES notation for N-cyclopentyloxy-3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanamide?
The canonical SMILES for N-cyclopentyloxy-3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanamide is CC1(C)NC(=O)N(CCC(=O)NOC2CCCC2)C1=O.
What is the InChIKey of N-cyclopentyloxy-3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanamide?
The InChIKey is KKLVINAVXCQYQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3O4/c1-13(2)11(18)16(12(19)14-13)8-7-10(17)15-20-9-5-3-4-6-9/h9H,3-8H2,1-2H3,(H,14,19)(H,15,17).
What are the key properties of N-cyclopentyloxy-3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanamide?
N-cyclopentyloxy-3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanamide has a molecular weight of 283.33 g/mol, XLogP of 0.70, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyloxy-3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanamide is sourced from PubChem (CID 83206350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).