C12H12FN3O2S — CID 83206786
2-amino-6-(2,5-dimethylpyrazol-3-yl)sulfanyl-3-fluorobenzoic acid (PubChem CID 83206786) has the molecular formula C12H12FN3O2S and a molecular weight of 281.31 g/mol. Its IUPAC name is 2-amino-6-(2,5-dimethylpyrazol-3-yl)sulfanyl-3-fluorobenzoic acid.
| Compound Name | 2-amino-6-(2,5-dimethylpyrazol-3-yl)sulfanyl-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 83206786 |
| Molecular Formula | C12H12FN3O2S |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 2-amino-6-(2,5-dimethylpyrazol-3-yl)sulfanyl-3-fluorobenzoic acid |
| SMILES | Cc1cc(Sc2ccc(F)c(N)c2C(=O)O)n(C)n1 |
| InChI | InChI=1S/C12H12FN3O2S/c1-6-5-9(16(2)15-6)19-8-4-3-7(13)11(14)10(8)12(17)18/h3-5H,14H2,1-2H3,(H,17,18) |
| InChIKey | BDYOAJPMMCXYIV-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|