C13H9FN4O2S — CID 83207534
2-amino-3-fluoro-6-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)benzoic acid (PubChem CID 83207534) has the molecular formula C13H9FN4O2S and a molecular weight of 304.31 g/mol. Its IUPAC name is 2-amino-3-fluoro-6-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)benzoic acid.
| Compound Name | 2-amino-3-fluoro-6-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)benzoic acid |
|---|---|
| PubChem CID | 83207534 |
| Molecular Formula | C13H9FN4O2S |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 2-amino-3-fluoro-6-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)benzoic acid |
| SMILES | Nc1c(F)ccc(Sc2nnc3ccccn23)c1C(=O)O |
| InChI | InChI=1S/C13H9FN4O2S/c14-7-4-5-8(10(11(7)15)12(19)20)21-13-17-16-9-3-1-2-6-18(9)13/h1-6H,15H2,(H,19,20) |
| InChIKey | XIJOXTIFYMZCJL-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|