C15H14FNO — CID 83208201
2-[(3-fluorophenyl)methyl]-6,7-dihydro-5H-isoindol-4-one (PubChem CID 83208201) has the molecular formula C15H14FNO and a molecular weight of 243.28 g/mol. Its IUPAC name is 2-[(3-fluorophenyl)methyl]-6,7-dihydro-5H-isoindol-4-one.
| Compound Name | 2-[(3-fluorophenyl)methyl]-6,7-dihydro-5H-isoindol-4-one |
|---|---|
| PubChem CID | 83208201 |
| Molecular Formula | C15H14FNO |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 2-[(3-fluorophenyl)methyl]-6,7-dihydro-5H-isoindol-4-one |
| SMILES | O=C1CCCc2cn(Cc3cccc(F)c3)cc21 |
| InChI | InChI=1S/C15H14FNO/c16-13-5-1-3-11(7-13)8-17-9-12-4-2-6-15(18)14(12)10-17/h1,3,5,7,9-10H,2,4,6,8H2 |
| InChIKey | JPGLOEJTUZOYTD-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |