C12H14F3NO2 — CID 83208621
2-[2-(2,2,2-trifluoroethoxy)ethyl]-6,7-dihydro-5H-isoindol-4-one (PubChem CID 83208621) has the molecular formula C12H14F3NO2 and a molecular weight of 261.24 g/mol. Its IUPAC name is 2-[2-(2,2,2-trifluoroethoxy)ethyl]-6,7-dihydro-5H-isoindol-4-one.
| Compound Name | 2-[2-(2,2,2-trifluoroethoxy)ethyl]-6,7-dihydro-5H-isoindol-4-one |
|---|---|
| PubChem CID | 83208621 |
| Molecular Formula | C12H14F3NO2 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 2-[2-(2,2,2-trifluoroethoxy)ethyl]-6,7-dihydro-5H-isoindol-4-one |
| SMILES | O=C1CCCc2cn(CCOCC(F)(F)F)cc21 |
| InChI | InChI=1S/C12H14F3NO2/c13-12(14,15)8-18-5-4-16-6-9-2-1-3-11(17)10(9)7-16/h6-7H,1-5,8H2 |
| InChIKey | ANNKRJUVAYQVBQ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|