C14H21F3N2O — CID 83208775
2-[3-(2,2,2-trifluoroethoxy)propyl]-5,6,7,8-tetrahydro-4H-cyclohepta[c]pyrrol-4-amine (PubChem CID 83208775) has the molecular formula C14H21F3N2O and a molecular weight of 290.33 g/mol. Its IUPAC name is 2-[3-(2,2,2-trifluoroethoxy)propyl]-5,6,7,8-tetrahydro-4H-cyclohepta[c]pyrrol-4-amine.
| Compound Name | 2-[3-(2,2,2-trifluoroethoxy)propyl]-5,6,7,8-tetrahydro-4H-cyclohepta[c]pyrrol-4-amine |
|---|---|
| PubChem CID | 83208775 |
| Molecular Formula | C14H21F3N2O |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 2-[3-(2,2,2-trifluoroethoxy)propyl]-5,6,7,8-tetrahydro-4H-cyclohepta[c]pyrrol-4-amine |
| SMILES | NC1CCCCc2cn(CCCOCC(F)(F)F)cc21 |
| InChI | InChI=1S/C14H21F3N2O/c15-14(16,17)10-20-7-3-6-19-8-11-4-1-2-5-13(18)12(11)9-19/h8-9,13H,1-7,10,18H2 |
| InChIKey | LSDRQVRAYDKHAW-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 40.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|