C15H16ClNO — CID 83208992
2-[(2-chlorophenyl)methyl]-4,5,6,7-tetrahydroisoindol-4-ol (PubChem CID 83208992) has the molecular formula C15H16ClNO and a molecular weight of 261.75 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl]-4,5,6,7-tetrahydroisoindol-4-ol.
| Compound Name | 2-[(2-chlorophenyl)methyl]-4,5,6,7-tetrahydroisoindol-4-ol |
|---|---|
| PubChem CID | 83208992 |
| Molecular Formula | C15H16ClNO |
| Molecular Weight | 261.75 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl]-4,5,6,7-tetrahydroisoindol-4-ol |
| SMILES | OC1CCCc2cn(Cc3ccccc3Cl)cc21 |
| InChI | InChI=1S/C15H16ClNO/c16-14-6-2-1-4-12(14)9-17-8-11-5-3-7-15(18)13(11)10-17/h1-2,4,6,8,10,15,18H,3,5,7,9H2 |
| InChIKey | GKLNPNNPSGZHAB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.75 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |