C14H21F3N2O — CID 83209091
N-methyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-5,6,7,8-tetrahydro-4H-cyclohepta[c]pyrrol-4-amine (PubChem CID 83209091) has the molecular formula C14H21F3N2O and a molecular weight of 290.33 g/mol. Its IUPAC name is N-methyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-5,6,7,8-tetrahydro-4H-cyclohepta[c]pyrrol-4-amine.
| Compound Name | N-methyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-5,6,7,8-tetrahydro-4H-cyclohepta[c]pyrrol-4-amine |
|---|---|
| PubChem CID | 83209091 |
| Molecular Formula | C14H21F3N2O |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | N-methyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-5,6,7,8-tetrahydro-4H-cyclohepta[c]pyrrol-4-amine |
| SMILES | CNC1CCCCc2cn(CCOCC(F)(F)F)cc21 |
| InChI | InChI=1S/C14H21F3N2O/c1-18-13-5-3-2-4-11-8-19(9-12(11)13)6-7-20-10-14(15,16)17/h8-9,13,18H,2-7,10H2,1H3 |
| InChIKey | XGNFURSXDUXOMZ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 26.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|