About N-methyl-3-(7-oxo-5,6-dihydro-4H-isoindol-2-yl)propanamide
N-methyl-3-(7-oxo-5,6-dihydro-4H-isoindol-2-yl)propanamide (PubChem CID 83209148) has the molecular formula C12H16N2O2
and a molecular weight of 220.27 g/mol. Its IUPAC name is N-methyl-3-(7-oxo-5,6-dihydro-4H-isoindol-2-yl)propanamide.
Molecular Properties
| Compound Name | N-methyl-3-(7-oxo-5,6-dihydro-4H-isoindol-2-yl)propanamide |
| PubChem CID | 83209148 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | N-methyl-3-(7-oxo-5,6-dihydro-4H-isoindol-2-yl)propanamide |
| SMILES | CNC(=O)CCn1cc2c(c1)C(=O)CCC2 |
| InChI | InChI=1S/C12H16N2O2/c1-13-12(16)5-6-14-7-9-3-2-4-11(15)10(9)8-14/h7-8H,2-6H2,1H3,(H,13,16) |
| InChIKey | XXNOJKHLDPIKCG-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-methyl-3-(7-oxo-5,6-dihydro-4H-isoindol-2-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-3-(7-oxo-5,6-dihydro-4H-isoindol-2-yl)propanamide?
The IUPAC name of N-methyl-3-(7-oxo-5,6-dihydro-4H-isoindol-2-yl)propanamide (CID 83209148) is N-methyl-3-(7-oxo-5,6-dihydro-4H-isoindol-2-yl)propanamide.
What is the SMILES notation for N-methyl-3-(7-oxo-5,6-dihydro-4H-isoindol-2-yl)propanamide?
The canonical SMILES for N-methyl-3-(7-oxo-5,6-dihydro-4H-isoindol-2-yl)propanamide is CNC(=O)CCn1cc2c(c1)C(=O)CCC2.
What is the InChIKey of N-methyl-3-(7-oxo-5,6-dihydro-4H-isoindol-2-yl)propanamide?
The InChIKey is XXNOJKHLDPIKCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O2/c1-13-12(16)5-6-14-7-9-3-2-4-11(15)10(9)8-14/h7-8H,2-6H2,1H3,(H,13,16).
What are the key properties of N-methyl-3-(7-oxo-5,6-dihydro-4H-isoindol-2-yl)propanamide?
N-methyl-3-(7-oxo-5,6-dihydro-4H-isoindol-2-yl)propanamide has a molecular weight of 220.27 g/mol, XLogP of 1.14, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-3-(7-oxo-5,6-dihydro-4H-isoindol-2-yl)propanamide is sourced from PubChem (CID 83209148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).