C13H18N2O — CID 83209165
4-(4-hydroxy-5,6,7,8-tetrahydro-4H-cyclohepta[c]pyrrol-2-yl)butanenitrile (PubChem CID 83209165) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 4-(4-hydroxy-5,6,7,8-tetrahydro-4H-cyclohepta[c]pyrrol-2-yl)butanenitrile.
| Compound Name | 4-(4-hydroxy-5,6,7,8-tetrahydro-4H-cyclohepta[c]pyrrol-2-yl)butanenitrile |
|---|---|
| PubChem CID | 83209165 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 4-(4-hydroxy-5,6,7,8-tetrahydro-4H-cyclohepta[c]pyrrol-2-yl)butanenitrile |
| SMILES | N#CCCCn1cc2c(c1)C(O)CCCC2 |
| InChI | InChI=1S/C13H18N2O/c14-7-3-4-8-15-9-11-5-1-2-6-13(16)12(11)10-15/h9-10,13,16H,1-6,8H2 |
| InChIKey | VXMYMJSSABEFFQ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|