C18H19NO — CID 83209171
2-(3-phenylprop-2-ynyl)-5,6,7,8-tetrahydro-4H-cyclohepta[c]pyrrol-4-ol (PubChem CID 83209171) has the molecular formula C18H19NO and a molecular weight of 265.36 g/mol. Its IUPAC name is 2-(3-phenylprop-2-ynyl)-5,6,7,8-tetrahydro-4H-cyclohepta[c]pyrrol-4-ol.
| Compound Name | 2-(3-phenylprop-2-ynyl)-5,6,7,8-tetrahydro-4H-cyclohepta[c]pyrrol-4-ol |
|---|---|
| PubChem CID | 83209171 |
| Molecular Formula | C18H19NO |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 2-(3-phenylprop-2-ynyl)-5,6,7,8-tetrahydro-4H-cyclohepta[c]pyrrol-4-ol |
| SMILES | OC1CCCCc2cn(CC#Cc3ccccc3)cc21 |
| InChI | InChI=1S/C18H19NO/c20-18-11-5-4-10-16-13-19(14-17(16)18)12-6-9-15-7-2-1-3-8-15/h1-3,7-8,13-14,18,20H,4-5,10-12H2 |
| InChIKey | HUYCKNJWWAKMIH-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|