C13H20N4O4 — CID 83209373
2-[(1,3-dimethyl-4-nitropyrazol-5-yl)amino]-1-methylcyclohexane-1-carboxylic acid (PubChem CID 83209373) has the molecular formula C13H20N4O4 and a molecular weight of 296.33 g/mol. Its IUPAC name is 2-[(1,3-dimethyl-4-nitropyrazol-5-yl)amino]-1-methylcyclohexane-1-carboxylic acid.
| Compound Name | 2-[(1,3-dimethyl-4-nitropyrazol-5-yl)amino]-1-methylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 83209373 |
| Molecular Formula | C13H20N4O4 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 2-[(1,3-dimethyl-4-nitropyrazol-5-yl)amino]-1-methylcyclohexane-1-carboxylic acid |
| SMILES | Cc1nn(C)c(NC2CCCCC2(C)C(=O)O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H20N4O4/c1-8-10(17(20)21)11(16(3)15-8)14-9-6-4-5-7-13(9,2)12(18)19/h9,14H,4-7H2,1-3H3,(H,18,19) |
| InChIKey | OGUDSFQDXHLLGD-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 110.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|