About 2-(hexylamino)ethyl carbamate
2-(hexylamino)ethyl carbamate (PubChem CID 83209542) has the molecular formula C9H20N2O2
and a molecular weight of 188.27 g/mol. Its IUPAC name is 2-(hexylamino)ethyl carbamate.
Molecular Properties
| Compound Name | 2-(hexylamino)ethyl carbamate |
| PubChem CID | 83209542 |
| Molecular Formula | C9H20N2O2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.15 |
| IUPAC Name | 2-(hexylamino)ethyl carbamate |
| SMILES | CCCCCCNCCOC(N)=O |
| InChI | InChI=1S/C9H20N2O2/c1-2-3-4-5-6-11-7-8-13-9(10)12/h11H,2-8H2,1H3,(H2,10,12) |
| InChIKey | KEKZVLRBUQXSFR-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(hexylamino)ethyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(hexylamino)ethyl carbamate?
The IUPAC name of 2-(hexylamino)ethyl carbamate (CID 83209542) is 2-(hexylamino)ethyl carbamate.
What is the SMILES notation for 2-(hexylamino)ethyl carbamate?
The canonical SMILES for 2-(hexylamino)ethyl carbamate is CCCCCCNCCOC(N)=O.
What is the InChIKey of 2-(hexylamino)ethyl carbamate?
The InChIKey is KEKZVLRBUQXSFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2O2/c1-2-3-4-5-6-11-7-8-13-9(10)12/h11H,2-8H2,1H3,(H2,10,12).
What are the key properties of 2-(hexylamino)ethyl carbamate?
2-(hexylamino)ethyl carbamate has a molecular weight of 188.27 g/mol, XLogP of 1.25, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hexylamino)ethyl carbamate is sourced from PubChem (CID 83209542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).