C8H15ClN2O3 — CID 83209558
2-[(3-chloro-2,2-dimethylpropanoyl)amino]ethyl carbamate (PubChem CID 83209558) has the molecular formula C8H15ClN2O3 and a molecular weight of 222.67 g/mol. Its IUPAC name is 2-[(3-chloro-2,2-dimethylpropanoyl)amino]ethyl carbamate.
| Compound Name | 2-[(3-chloro-2,2-dimethylpropanoyl)amino]ethyl carbamate |
|---|---|
| PubChem CID | 83209558 |
| Molecular Formula | C8H15ClN2O3 |
| Molecular Weight | 222.67 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 2-[(3-chloro-2,2-dimethylpropanoyl)amino]ethyl carbamate |
| SMILES | CC(C)(CCl)C(=O)NCCOC(N)=O |
| InChI | InChI=1S/C8H15ClN2O3/c1-8(2,5-9)6(12)11-3-4-14-7(10)13/h3-5H2,1-2H3,(H2,10,13)(H,11,12) |
| InChIKey | YCLKBHQDFDQMAB-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.67 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|