About 2-[(3-chloro-2,2-dimethylpropanoyl)amino]ethyl carbamate
2-[(3-chloro-2,2-dimethylpropanoyl)amino]ethyl carbamate (PubChem CID 83209558) has the molecular formula C8H15ClN2O3
and a molecular weight of 222.67 g/mol. Its IUPAC name is 2-[(3-chloro-2,2-dimethylpropanoyl)amino]ethyl carbamate.
Molecular Properties
| Compound Name | 2-[(3-chloro-2,2-dimethylpropanoyl)amino]ethyl carbamate |
| PubChem CID | 83209558 |
| Molecular Formula | C8H15ClN2O3 |
| Molecular Weight | 222.67 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 2-[(3-chloro-2,2-dimethylpropanoyl)amino]ethyl carbamate |
| SMILES | CC(C)(CCl)C(=O)NCCOC(N)=O |
| InChI | InChI=1S/C8H15ClN2O3/c1-8(2,5-9)6(12)11-3-4-14-7(10)13/h3-5H2,1-2H3,(H2,10,13)(H,11,12) |
| InChIKey | YCLKBHQDFDQMAB-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.67 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3-chloro-2,2-dimethylpropanoyl)amino]ethyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3-chloro-2,2-dimethylpropanoyl)amino]ethyl carbamate?
The IUPAC name of 2-[(3-chloro-2,2-dimethylpropanoyl)amino]ethyl carbamate (CID 83209558) is 2-[(3-chloro-2,2-dimethylpropanoyl)amino]ethyl carbamate.
What is the SMILES notation for 2-[(3-chloro-2,2-dimethylpropanoyl)amino]ethyl carbamate?
The canonical SMILES for 2-[(3-chloro-2,2-dimethylpropanoyl)amino]ethyl carbamate is CC(C)(CCl)C(=O)NCCOC(N)=O.
What is the InChIKey of 2-[(3-chloro-2,2-dimethylpropanoyl)amino]ethyl carbamate?
The InChIKey is YCLKBHQDFDQMAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15ClN2O3/c1-8(2,5-9)6(12)11-3-4-14-7(10)13/h3-5H2,1-2H3,(H2,10,13)(H,11,12).
What are the key properties of 2-[(3-chloro-2,2-dimethylpropanoyl)amino]ethyl carbamate?
2-[(3-chloro-2,2-dimethylpropanoyl)amino]ethyl carbamate has a molecular weight of 222.67 g/mol, XLogP of 0.46, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-chloro-2,2-dimethylpropanoyl)amino]ethyl carbamate is sourced from PubChem (CID 83209558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).