About 1-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-5-methyl-2,3-dihydroindol-6-amine
1-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-5-methyl-2,3-dihydroindol-6-amine (PubChem CID 83209888) has the molecular formula C17H23N3S
and a molecular weight of 301.46 g/mol. Its IUPAC name is 1-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-5-methyl-2,3-dihydroindol-6-amine.
Molecular Properties
| Compound Name | 1-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-5-methyl-2,3-dihydroindol-6-amine |
| PubChem CID | 83209888 |
| Molecular Formula | C17H23N3S |
| Molecular Weight | 301.46 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | 1-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-5-methyl-2,3-dihydroindol-6-amine |
| SMILES | Cc1cc2c(cc1N)N(Cc1nc(C(C)(C)C)cs1)CC2 |
| InChI | InChI=1S/C17H23N3S/c1-11-7-12-5-6-20(14(12)8-13(11)18)9-16-19-15(10-21-16)17(2,3)4/h7-8,10H,5-6,9,18H2,1-4H3 |
| InChIKey | VYJAJSUCTKXDEO-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-5-methyl-2,3-dihydroindol-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-5-methyl-2,3-dihydroindol-6-amine?
The IUPAC name of 1-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-5-methyl-2,3-dihydroindol-6-amine (CID 83209888) is 1-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-5-methyl-2,3-dihydroindol-6-amine.
What is the SMILES notation for 1-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-5-methyl-2,3-dihydroindol-6-amine?
The canonical SMILES for 1-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-5-methyl-2,3-dihydroindol-6-amine is Cc1cc2c(cc1N)N(Cc1nc(C(C)(C)C)cs1)CC2.
What is the InChIKey of 1-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-5-methyl-2,3-dihydroindol-6-amine?
The InChIKey is VYJAJSUCTKXDEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N3S/c1-11-7-12-5-6-20(14(12)8-13(11)18)9-16-19-15(10-21-16)17(2,3)4/h7-8,10H,5-6,9,18H2,1-4H3.
What are the key properties of 1-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-5-methyl-2,3-dihydroindol-6-amine?
1-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-5-methyl-2,3-dihydroindol-6-amine has a molecular weight of 301.46 g/mol, XLogP of 3.89, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-5-methyl-2,3-dihydroindol-6-amine is sourced from PubChem (CID 83209888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).