About 1-methyl-2-(thieno[3,2-b]thiophene-5-carbonylamino)cyclohexane-1-carboxylic acid
1-methyl-2-(thieno[3,2-b]thiophene-5-carbonylamino)cyclohexane-1-carboxylic acid (PubChem CID 83211818) has the molecular formula C15H17NO3S2
and a molecular weight of 323.44 g/mol. Its IUPAC name is 1-methyl-2-(thieno[3,2-b]thiophene-5-carbonylamino)cyclohexane-1-carboxylic acid.
Molecular Properties
| Compound Name | 1-methyl-2-(thieno[3,2-b]thiophene-5-carbonylamino)cyclohexane-1-carboxylic acid |
| PubChem CID | 83211818 |
| Molecular Formula | C15H17NO3S2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 1-methyl-2-(thieno[3,2-b]thiophene-5-carbonylamino)cyclohexane-1-carboxylic acid |
| SMILES | CC1(C(=O)O)CCCCC1NC(=O)c1cc2sccc2s1 |
| InChI | InChI=1S/C15H17NO3S2/c1-15(14(18)19)6-3-2-4-12(15)16-13(17)11-8-10-9(21-11)5-7-20-10/h5,7-8,12H,2-4,6H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | MCNCUWZAWGJYPC-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methyl-2-(thieno[3,2-b]thiophene-5-carbonylamino)cyclohexane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2-(thieno[3,2-b]thiophene-5-carbonylamino)cyclohexane-1-carboxylic acid?
The IUPAC name of 1-methyl-2-(thieno[3,2-b]thiophene-5-carbonylamino)cyclohexane-1-carboxylic acid (CID 83211818) is 1-methyl-2-(thieno[3,2-b]thiophene-5-carbonylamino)cyclohexane-1-carboxylic acid.
What is the SMILES notation for 1-methyl-2-(thieno[3,2-b]thiophene-5-carbonylamino)cyclohexane-1-carboxylic acid?
The canonical SMILES for 1-methyl-2-(thieno[3,2-b]thiophene-5-carbonylamino)cyclohexane-1-carboxylic acid is CC1(C(=O)O)CCCCC1NC(=O)c1cc2sccc2s1.
What is the InChIKey of 1-methyl-2-(thieno[3,2-b]thiophene-5-carbonylamino)cyclohexane-1-carboxylic acid?
The InChIKey is MCNCUWZAWGJYPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO3S2/c1-15(14(18)19)6-3-2-4-12(15)16-13(17)11-8-10-9(21-11)5-7-20-10/h5,7-8,12H,2-4,6H2,1H3,(H,16,17)(H,18,19).
What are the key properties of 1-methyl-2-(thieno[3,2-b]thiophene-5-carbonylamino)cyclohexane-1-carboxylic acid?
1-methyl-2-(thieno[3,2-b]thiophene-5-carbonylamino)cyclohexane-1-carboxylic acid has a molecular weight of 323.44 g/mol, XLogP of 3.73, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2-(thieno[3,2-b]thiophene-5-carbonylamino)cyclohexane-1-carboxylic acid is sourced from PubChem (CID 83211818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).