C9H18N2O3 — CID 83212137
2-[(5-methyloxolan-2-yl)methylamino]ethyl carbamate (PubChem CID 83212137) has the molecular formula C9H18N2O3 and a molecular weight of 202.25 g/mol. Its IUPAC name is 2-[(5-methyloxolan-2-yl)methylamino]ethyl carbamate.
| Compound Name | 2-[(5-methyloxolan-2-yl)methylamino]ethyl carbamate |
|---|---|
| PubChem CID | 83212137 |
| Molecular Formula | C9H18N2O3 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | 2-[(5-methyloxolan-2-yl)methylamino]ethyl carbamate |
| SMILES | CC1CCC(CNCCOC(N)=O)O1 |
| InChI | InChI=1S/C9H18N2O3/c1-7-2-3-8(14-7)6-11-4-5-13-9(10)12/h7-8,11H,2-6H2,1H3,(H2,10,12) |
| InChIKey | NNMLNNNLAYHJGB-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|