About (6-amino-5-methyl-2,3-dihydroindol-1-yl)-(1,4-dioxan-2-yl)methanone
(6-amino-5-methyl-2,3-dihydroindol-1-yl)-(1,4-dioxan-2-yl)methanone (PubChem CID 83212270) has the molecular formula C14H18N2O3
and a molecular weight of 262.31 g/mol. Its IUPAC name is (6-amino-5-methyl-2,3-dihydroindol-1-yl)-(1,4-dioxan-2-yl)methanone.
Molecular Properties
| Compound Name | (6-amino-5-methyl-2,3-dihydroindol-1-yl)-(1,4-dioxan-2-yl)methanone |
| PubChem CID | 83212270 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | (6-amino-5-methyl-2,3-dihydroindol-1-yl)-(1,4-dioxan-2-yl)methanone |
| SMILES | Cc1cc2c(cc1N)N(C(=O)C1COCCO1)CC2 |
| InChI | InChI=1S/C14H18N2O3/c1-9-6-10-2-3-16(12(10)7-11(9)15)14(17)13-8-18-4-5-19-13/h6-7,13H,2-5,8,15H2,1H3 |
| InChIKey | IUACGJVIKQUIOQ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (6-amino-5-methyl-2,3-dihydroindol-1-yl)-(1,4-dioxan-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-amino-5-methyl-2,3-dihydroindol-1-yl)-(1,4-dioxan-2-yl)methanone?
The IUPAC name of (6-amino-5-methyl-2,3-dihydroindol-1-yl)-(1,4-dioxan-2-yl)methanone (CID 83212270) is (6-amino-5-methyl-2,3-dihydroindol-1-yl)-(1,4-dioxan-2-yl)methanone.
What is the SMILES notation for (6-amino-5-methyl-2,3-dihydroindol-1-yl)-(1,4-dioxan-2-yl)methanone?
The canonical SMILES for (6-amino-5-methyl-2,3-dihydroindol-1-yl)-(1,4-dioxan-2-yl)methanone is Cc1cc2c(cc1N)N(C(=O)C1COCCO1)CC2.
What is the InChIKey of (6-amino-5-methyl-2,3-dihydroindol-1-yl)-(1,4-dioxan-2-yl)methanone?
The InChIKey is IUACGJVIKQUIOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O3/c1-9-6-10-2-3-16(12(10)7-11(9)15)14(17)13-8-18-4-5-19-13/h6-7,13H,2-5,8,15H2,1H3.
What are the key properties of (6-amino-5-methyl-2,3-dihydroindol-1-yl)-(1,4-dioxan-2-yl)methanone?
(6-amino-5-methyl-2,3-dihydroindol-1-yl)-(1,4-dioxan-2-yl)methanone has a molecular weight of 262.31 g/mol, XLogP of 0.88, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-amino-5-methyl-2,3-dihydroindol-1-yl)-(1,4-dioxan-2-yl)methanone is sourced from PubChem (CID 83212270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).