About tert-butyl 6-amino-5-methyl-2,3-dihydroindole-1-carboxylate
tert-butyl 6-amino-5-methyl-2,3-dihydroindole-1-carboxylate (PubChem CID 83212361) has the molecular formula C14H20N2O2
and a molecular weight of 248.33 g/mol. Its IUPAC name is tert-butyl 6-amino-5-methyl-2,3-dihydroindole-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 6-amino-5-methyl-2,3-dihydroindole-1-carboxylate |
| PubChem CID | 83212361 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | tert-butyl 6-amino-5-methyl-2,3-dihydroindole-1-carboxylate |
| SMILES | Cc1cc2c(cc1N)N(C(=O)OC(C)(C)C)CC2 |
| InChI | InChI=1S/C14H20N2O2/c1-9-7-10-5-6-16(12(10)8-11(9)15)13(17)18-14(2,3)4/h7-8H,5-6,15H2,1-4H3 |
| InChIKey | ABEKZHQHASZMDE-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 6-amino-5-methyl-2,3-dihydroindole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 6-amino-5-methyl-2,3-dihydroindole-1-carboxylate?
The IUPAC name of tert-butyl 6-amino-5-methyl-2,3-dihydroindole-1-carboxylate (CID 83212361) is tert-butyl 6-amino-5-methyl-2,3-dihydroindole-1-carboxylate.
What is the SMILES notation for tert-butyl 6-amino-5-methyl-2,3-dihydroindole-1-carboxylate?
The canonical SMILES for tert-butyl 6-amino-5-methyl-2,3-dihydroindole-1-carboxylate is Cc1cc2c(cc1N)N(C(=O)OC(C)(C)C)CC2.
What is the InChIKey of tert-butyl 6-amino-5-methyl-2,3-dihydroindole-1-carboxylate?
The InChIKey is ABEKZHQHASZMDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O2/c1-9-7-10-5-6-16(12(10)8-11(9)15)13(17)18-14(2,3)4/h7-8H,5-6,15H2,1-4H3.
What are the key properties of tert-butyl 6-amino-5-methyl-2,3-dihydroindole-1-carboxylate?
tert-butyl 6-amino-5-methyl-2,3-dihydroindole-1-carboxylate has a molecular weight of 248.33 g/mol, XLogP of 2.87, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 6-amino-5-methyl-2,3-dihydroindole-1-carboxylate is sourced from PubChem (CID 83212361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).