C9H11F2NO — CID 83212417
2-(difluoromethyl)-4,5,6,7-tetrahydroisoindol-4-ol (PubChem CID 83212417) has the molecular formula C9H11F2NO and a molecular weight of 187.19 g/mol. Its IUPAC name is 2-(difluoromethyl)-4,5,6,7-tetrahydroisoindol-4-ol.
| Compound Name | 2-(difluoromethyl)-4,5,6,7-tetrahydroisoindol-4-ol |
|---|---|
| PubChem CID | 83212417 |
| Molecular Formula | C9H11F2NO |
| Molecular Weight | 187.19 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | 2-(difluoromethyl)-4,5,6,7-tetrahydroisoindol-4-ol |
| SMILES | OC1CCCc2cn(C(F)F)cc21 |
| InChI | InChI=1S/C9H11F2NO/c10-9(11)12-4-6-2-1-3-8(13)7(6)5-12/h4-5,8-9,13H,1-3H2 |
| InChIKey | WQXTVCNZMLNFTL-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.19 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |