C13H19F3N2O — CID 83213013
2-[3-(2,2,2-trifluoroethoxy)propyl]-4,5,6,7-tetrahydroisoindol-4-amine (PubChem CID 83213013) has the molecular formula C13H19F3N2O and a molecular weight of 276.30 g/mol. Its IUPAC name is 2-[3-(2,2,2-trifluoroethoxy)propyl]-4,5,6,7-tetrahydroisoindol-4-amine.
| Compound Name | 2-[3-(2,2,2-trifluoroethoxy)propyl]-4,5,6,7-tetrahydroisoindol-4-amine |
|---|---|
| PubChem CID | 83213013 |
| Molecular Formula | C13H19F3N2O |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 2-[3-(2,2,2-trifluoroethoxy)propyl]-4,5,6,7-tetrahydroisoindol-4-amine |
| SMILES | NC1CCCc2cn(CCCOCC(F)(F)F)cc21 |
| InChI | InChI=1S/C13H19F3N2O/c14-13(15,16)9-19-6-2-5-18-7-10-3-1-4-12(17)11(10)8-18/h7-8,12H,1-6,9,17H2 |
| InChIKey | FJJALBCXIRMVEJ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 40.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|