C14H24N2O — CID 83213099
2-(2-butoxyethyl)-4,5,6,7-tetrahydroisoindol-4-amine (PubChem CID 83213099) has the molecular formula C14H24N2O and a molecular weight of 236.36 g/mol. Its IUPAC name is 2-(2-butoxyethyl)-4,5,6,7-tetrahydroisoindol-4-amine.
| Compound Name | 2-(2-butoxyethyl)-4,5,6,7-tetrahydroisoindol-4-amine |
|---|---|
| PubChem CID | 83213099 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | 2-(2-butoxyethyl)-4,5,6,7-tetrahydroisoindol-4-amine |
| SMILES | CCCCOCCn1cc2c(c1)C(N)CCC2 |
| InChI | InChI=1S/C14H24N2O/c1-2-3-8-17-9-7-16-10-12-5-4-6-14(15)13(12)11-16/h10-11,14H,2-9,15H2,1H3 |
| InChIKey | SFNQBNHMORQJNO-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 40.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|