About (6-amino-5-methyl-2,3-dihydroindol-1-yl)-(4-ethylthiadiazol-5-yl)methanone
(6-amino-5-methyl-2,3-dihydroindol-1-yl)-(4-ethylthiadiazol-5-yl)methanone (PubChem CID 83213348) has the molecular formula C14H16N4OS
and a molecular weight of 288.38 g/mol. Its IUPAC name is (6-amino-5-methyl-2,3-dihydroindol-1-yl)-(4-ethylthiadiazol-5-yl)methanone.
Molecular Properties
| Compound Name | (6-amino-5-methyl-2,3-dihydroindol-1-yl)-(4-ethylthiadiazol-5-yl)methanone |
| PubChem CID | 83213348 |
| Molecular Formula | C14H16N4OS |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | (6-amino-5-methyl-2,3-dihydroindol-1-yl)-(4-ethylthiadiazol-5-yl)methanone |
| SMILES | CCc1nnsc1C(=O)N1CCc2cc(C)c(N)cc21 |
| InChI | InChI=1S/C14H16N4OS/c1-3-11-13(20-17-16-11)14(19)18-5-4-9-6-8(2)10(15)7-12(9)18/h6-7H,3-5,15H2,1-2H3 |
| InChIKey | SYNDWTVDCKIQBN-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (6-amino-5-methyl-2,3-dihydroindol-1-yl)-(4-ethylthiadiazol-5-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-amino-5-methyl-2,3-dihydroindol-1-yl)-(4-ethylthiadiazol-5-yl)methanone?
The IUPAC name of (6-amino-5-methyl-2,3-dihydroindol-1-yl)-(4-ethylthiadiazol-5-yl)methanone (CID 83213348) is (6-amino-5-methyl-2,3-dihydroindol-1-yl)-(4-ethylthiadiazol-5-yl)methanone.
What is the SMILES notation for (6-amino-5-methyl-2,3-dihydroindol-1-yl)-(4-ethylthiadiazol-5-yl)methanone?
The canonical SMILES for (6-amino-5-methyl-2,3-dihydroindol-1-yl)-(4-ethylthiadiazol-5-yl)methanone is CCc1nnsc1C(=O)N1CCc2cc(C)c(N)cc21.
What is the InChIKey of (6-amino-5-methyl-2,3-dihydroindol-1-yl)-(4-ethylthiadiazol-5-yl)methanone?
The InChIKey is SYNDWTVDCKIQBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N4OS/c1-3-11-13(20-17-16-11)14(19)18-5-4-9-6-8(2)10(15)7-12(9)18/h6-7H,3-5,15H2,1-2H3.
What are the key properties of (6-amino-5-methyl-2,3-dihydroindol-1-yl)-(4-ethylthiadiazol-5-yl)methanone?
(6-amino-5-methyl-2,3-dihydroindol-1-yl)-(4-ethylthiadiazol-5-yl)methanone has a molecular weight of 288.38 g/mol, XLogP of 2.19, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (6-amino-5-methyl-2,3-dihydroindol-1-yl)-(4-ethylthiadiazol-5-yl)methanone is sourced from PubChem (CID 83213348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).