About 2-[(1,5-dimethylpyrrole-2-carbonyl)amino]-1-methylcyclohexane-1-carboxylic acid
2-[(1,5-dimethylpyrrole-2-carbonyl)amino]-1-methylcyclohexane-1-carboxylic acid (PubChem CID 83213821) has the molecular formula C15H22N2O3
and a molecular weight of 278.35 g/mol. Its IUPAC name is 2-[(1,5-dimethylpyrrole-2-carbonyl)amino]-1-methylcyclohexane-1-carboxylic acid.
Molecular Properties
| Compound Name | 2-[(1,5-dimethylpyrrole-2-carbonyl)amino]-1-methylcyclohexane-1-carboxylic acid |
| PubChem CID | 83213821 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 2-[(1,5-dimethylpyrrole-2-carbonyl)amino]-1-methylcyclohexane-1-carboxylic acid |
| SMILES | Cc1ccc(C(=O)NC2CCCCC2(C)C(=O)O)n1C |
| InChI | InChI=1S/C15H22N2O3/c1-10-7-8-11(17(10)3)13(18)16-12-6-4-5-9-15(12,2)14(19)20/h7-8,12H,4-6,9H2,1-3H3,(H,16,18)(H,19,20) |
| InChIKey | STQVYIRMENGHGL-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(1,5-dimethylpyrrole-2-carbonyl)amino]-1-methylcyclohexane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1,5-dimethylpyrrole-2-carbonyl)amino]-1-methylcyclohexane-1-carboxylic acid?
The IUPAC name of 2-[(1,5-dimethylpyrrole-2-carbonyl)amino]-1-methylcyclohexane-1-carboxylic acid (CID 83213821) is 2-[(1,5-dimethylpyrrole-2-carbonyl)amino]-1-methylcyclohexane-1-carboxylic acid.
What is the SMILES notation for 2-[(1,5-dimethylpyrrole-2-carbonyl)amino]-1-methylcyclohexane-1-carboxylic acid?
The canonical SMILES for 2-[(1,5-dimethylpyrrole-2-carbonyl)amino]-1-methylcyclohexane-1-carboxylic acid is Cc1ccc(C(=O)NC2CCCCC2(C)C(=O)O)n1C.
What is the InChIKey of 2-[(1,5-dimethylpyrrole-2-carbonyl)amino]-1-methylcyclohexane-1-carboxylic acid?
The InChIKey is STQVYIRMENGHGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O3/c1-10-7-8-11(17(10)3)13(18)16-12-6-4-5-9-15(12,2)14(19)20/h7-8,12H,4-6,9H2,1-3H3,(H,16,18)(H,19,20).
What are the key properties of 2-[(1,5-dimethylpyrrole-2-carbonyl)amino]-1-methylcyclohexane-1-carboxylic acid?
2-[(1,5-dimethylpyrrole-2-carbonyl)amino]-1-methylcyclohexane-1-carboxylic acid has a molecular weight of 278.35 g/mol, XLogP of 2.10, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1,5-dimethylpyrrole-2-carbonyl)amino]-1-methylcyclohexane-1-carboxylic acid is sourced from PubChem (CID 83213821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).